C15H19N3O3S2 — CID 90597489
3-methoxy-N-[1-(1,3-thiazol-2-yl)piperidin-4-yl]benzenesulfonamide (PubChem CID 90597489) has the molecular formula C15H19N3O3S2 and a molecular weight of 353.47 g/mol. Its IUPAC name is 3-methoxy-N-[1-(1,3-thiazol-2-yl)piperidin-4-yl]benzenesulfonamide.
| Compound Name | 3-methoxy-N-[1-(1,3-thiazol-2-yl)piperidin-4-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 90597489 |
| Molecular Formula | C15H19N3O3S2 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | 3-methoxy-N-[1-(1,3-thiazol-2-yl)piperidin-4-yl]benzenesulfonamide |
| SMILES | COc1cccc(S(=O)(=O)NC2CCN(c3nccs3)CC2)c1 |
| InChI | InChI=1S/C15H19N3O3S2/c1-21-13-3-2-4-14(11-13)23(19,20)17-12-5-8-18(9-6-12)15-16-7-10-22-15/h2-4,7,10-12,17H,5-6,8-9H2,1H3 |
| InChIKey | QICRRHPQYLKXKT-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |