C11H19N3O2S2 — CID 90597545
N-[1-(1,3-thiazol-2-yl)piperidin-4-yl]propane-1-sulfonamide (PubChem CID 90597545) has the molecular formula C11H19N3O2S2 and a molecular weight of 289.43 g/mol. Its IUPAC name is N-[1-(1,3-thiazol-2-yl)piperidin-4-yl]propane-1-sulfonamide.
| Compound Name | N-[1-(1,3-thiazol-2-yl)piperidin-4-yl]propane-1-sulfonamide |
|---|---|
| PubChem CID | 90597545 |
| Molecular Formula | C11H19N3O2S2 |
| Molecular Weight | 289.43 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | N-[1-(1,3-thiazol-2-yl)piperidin-4-yl]propane-1-sulfonamide |
| SMILES | CCCS(=O)(=O)NC1CCN(c2nccs2)CC1 |
| InChI | InChI=1S/C11H19N3O2S2/c1-2-9-18(15,16)13-10-3-6-14(7-4-10)11-12-5-8-17-11/h5,8,10,13H,2-4,6-7,9H2,1H3 |
| InChIKey | QVWFGWDKCWQOSP-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.43 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |