C17H23N3O2S2 — CID 90597507
4-propan-2-yl-N-[1-(1,3-thiazol-2-yl)piperidin-4-yl]benzenesulfonamide (PubChem CID 90597507) has the molecular formula C17H23N3O2S2 and a molecular weight of 365.52 g/mol. Its IUPAC name is 4-propan-2-yl-N-[1-(1,3-thiazol-2-yl)piperidin-4-yl]benzenesulfonamide.
| Compound Name | 4-propan-2-yl-N-[1-(1,3-thiazol-2-yl)piperidin-4-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 90597507 |
| Molecular Formula | C17H23N3O2S2 |
| Molecular Weight | 365.52 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | 4-propan-2-yl-N-[1-(1,3-thiazol-2-yl)piperidin-4-yl]benzenesulfonamide |
| SMILES | CC(C)c1ccc(S(=O)(=O)NC2CCN(c3nccs3)CC2)cc1 |
| InChI | InChI=1S/C17H23N3O2S2/c1-13(2)14-3-5-16(6-4-14)24(21,22)19-15-7-10-20(11-8-15)17-18-9-12-23-17/h3-6,9,12-13,15,19H,7-8,10-11H2,1-2H3 |
| InChIKey | WNXGRJDGVSJKKO-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.52 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |