C14H15F2N3O2S2 — CID 90597498
3,4-difluoro-N-[1-(1,3-thiazol-2-yl)piperidin-4-yl]benzenesulfonamide (PubChem CID 90597498) has the molecular formula C14H15F2N3O2S2 and a molecular weight of 359.42 g/mol. Its IUPAC name is 3,4-difluoro-N-[1-(1,3-thiazol-2-yl)piperidin-4-yl]benzenesulfonamide.
| Compound Name | 3,4-difluoro-N-[1-(1,3-thiazol-2-yl)piperidin-4-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 90597498 |
| Molecular Formula | C14H15F2N3O2S2 |
| Molecular Weight | 359.42 g/mol |
| Exact Mass | 359.06 |
| IUPAC Name | 3,4-difluoro-N-[1-(1,3-thiazol-2-yl)piperidin-4-yl]benzenesulfonamide |
| SMILES | O=S(=O)(NC1CCN(c2nccs2)CC1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C14H15F2N3O2S2/c15-12-2-1-11(9-13(12)16)23(20,21)18-10-3-6-19(7-4-10)14-17-5-8-22-14/h1-2,5,8-10,18H,3-4,6-7H2 |
| InChIKey | LGXVGSXBALHEBF-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.42 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |