C19H25N3O2S — CID 90597226
4-butoxy-N-[1-(1,3-thiazol-2-yl)piperidin-4-yl]benzamide (PubChem CID 90597226) has the molecular formula C19H25N3O2S and a molecular weight of 359.50 g/mol. Its IUPAC name is 4-butoxy-N-[1-(1,3-thiazol-2-yl)piperidin-4-yl]benzamide.
| Compound Name | 4-butoxy-N-[1-(1,3-thiazol-2-yl)piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 90597226 |
| Molecular Formula | C19H25N3O2S |
| Molecular Weight | 359.50 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | 4-butoxy-N-[1-(1,3-thiazol-2-yl)piperidin-4-yl]benzamide |
| SMILES | CCCCOc1ccc(C(=O)NC2CCN(c3nccs3)CC2)cc1 |
| InChI | InChI=1S/C19H25N3O2S/c1-2-3-13-24-17-6-4-15(5-7-17)18(23)21-16-8-11-22(12-9-16)19-20-10-14-25-19/h4-7,10,14,16H,2-3,8-9,11-13H2,1H3,(H,21,23) |
| InChIKey | GFLQYAJYNUWEMS-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.50 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|