C11H17F3N4S — CID 62573229
2,2,2-trifluoro-N-[2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]ethyl]ethanamine (PubChem CID 62573229) has the molecular formula C11H17F3N4S and a molecular weight of 294.35 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]ethyl]ethanamine.
| Compound Name | 2,2,2-trifluoro-N-[2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]ethyl]ethanamine |
|---|---|
| PubChem CID | 62573229 |
| Molecular Formula | C11H17F3N4S |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | 2,2,2-trifluoro-N-[2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]ethyl]ethanamine |
| SMILES | FC(F)(F)CNCCN1CCN(c2nccs2)CC1 |
| InChI | InChI=1S/C11H17F3N4S/c12-11(13,14)9-15-1-3-17-4-6-18(7-5-17)10-16-2-8-19-10/h2,8,15H,1,3-7,9H2 |
| InChIKey | IZWUMAUDYNSTFW-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 31.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|