C15H19BrN4S — CID 62573949
2-bromo-N-[2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]ethyl]aniline (PubChem CID 62573949) has the molecular formula C15H19BrN4S and a molecular weight of 367.32 g/mol. Its IUPAC name is 2-bromo-N-[2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]ethyl]aniline.
| Compound Name | 2-bromo-N-[2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]ethyl]aniline |
|---|---|
| PubChem CID | 62573949 |
| Molecular Formula | C15H19BrN4S |
| Molecular Weight | 367.32 g/mol |
| Exact Mass | 366.05 |
| IUPAC Name | 2-bromo-N-[2-[4-(1,3-thiazol-2-yl)piperazin-1-yl]ethyl]aniline |
| SMILES | Brc1ccccc1NCCN1CCN(c2nccs2)CC1 |
| InChI | InChI=1S/C15H19BrN4S/c16-13-3-1-2-4-14(13)17-5-7-19-8-10-20(11-9-19)15-18-6-12-21-15/h1-4,6,12,17H,5,7-11H2 |
| InChIKey | BAHMNHKLLBMZLV-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 31.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.32 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |