C19H21N3OS — CID 71897059
2-[4-(2-naphthalen-2-yloxyethyl)piperazin-1-yl]-1,3-thiazole (PubChem CID 71897059) has the molecular formula C19H21N3OS and a molecular weight of 339.46 g/mol. Its IUPAC name is 2-[4-(2-naphthalen-2-yloxyethyl)piperazin-1-yl]-1,3-thiazole.
| Compound Name | 2-[4-(2-naphthalen-2-yloxyethyl)piperazin-1-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 71897059 |
| Molecular Formula | C19H21N3OS |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.14 |
| IUPAC Name | 2-[4-(2-naphthalen-2-yloxyethyl)piperazin-1-yl]-1,3-thiazole |
| SMILES | c1ccc2cc(OCCN3CCN(c4nccs4)CC3)ccc2c1 |
| InChI | InChI=1S/C19H21N3OS/c1-2-4-17-15-18(6-5-16(17)3-1)23-13-12-21-8-10-22(11-9-21)19-20-7-14-24-19/h1-7,14-15H,8-13H2 |
| InChIKey | JYDFEWXWBUIWMW-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 28.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |