C17H17N3O2S2 — CID 17451097
2-(4-naphthalen-2-ylsulfonylpiperazin-1-yl)-1,3-thiazole (PubChem CID 17451097) has the molecular formula C17H17N3O2S2 and a molecular weight of 359.48 g/mol. Its IUPAC name is 2-(4-naphthalen-2-ylsulfonylpiperazin-1-yl)-1,3-thiazole.
| Compound Name | 2-(4-naphthalen-2-ylsulfonylpiperazin-1-yl)-1,3-thiazole |
|---|---|
| PubChem CID | 17451097 |
| Molecular Formula | C17H17N3O2S2 |
| Molecular Weight | 359.48 g/mol |
| Exact Mass | 359.08 |
| IUPAC Name | 2-(4-naphthalen-2-ylsulfonylpiperazin-1-yl)-1,3-thiazole |
| SMILES | O=S(=O)(c1ccc2ccccc2c1)N1CCN(c2nccs2)CC1 |
| InChI | InChI=1S/C17H17N3O2S2/c21-24(22,16-6-5-14-3-1-2-4-15(14)13-16)20-10-8-19(9-11-20)17-18-7-12-23-17/h1-7,12-13H,8-11H2 |
| InChIKey | GWRUTBIRQQHHJO-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.48 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |