C15H15N5O4S2 — CID 24627168
6-[4-(1,3-thiazol-2-yl)piperazin-1-yl]sulfonyl-1,4-dihydroquinoxaline-2,3-dione (PubChem CID 24627168) has the molecular formula C15H15N5O4S2 and a molecular weight of 393.45 g/mol. Its IUPAC name is 6-[4-(1,3-thiazol-2-yl)piperazin-1-yl]sulfonyl-1,4-dihydroquinoxaline-2,3-dione.
| Compound Name | 6-[4-(1,3-thiazol-2-yl)piperazin-1-yl]sulfonyl-1,4-dihydroquinoxaline-2,3-dione |
|---|---|
| PubChem CID | 24627168 |
| Molecular Formula | C15H15N5O4S2 |
| Molecular Weight | 393.45 g/mol |
| Exact Mass | 393.06 |
| IUPAC Name | 6-[4-(1,3-thiazol-2-yl)piperazin-1-yl]sulfonyl-1,4-dihydroquinoxaline-2,3-dione |
| SMILES | O=c1[nH]c2ccc(S(=O)(=O)N3CCN(c4nccs4)CC3)cc2[nH]c1=O |
| InChI | InChI=1S/C15H15N5O4S2/c21-13-14(22)18-12-9-10(1-2-11(12)17-13)26(23,24)20-6-4-19(5-7-20)15-16-3-8-25-15/h1-3,8-9H,4-7H2,(H,17,21)(H,18,22) |
| InChIKey | RXKYHMMZXOPIDA-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 119.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.45 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|