C20H19N5O4S3 — CID 24656784
6-[4-[(2-thiophen-3-yl-1,3-thiazol-4-yl)methyl]piperazin-1-yl]sulfonyl-1,4-dihydroquinoxaline-2,3-dione (PubChem CID 24656784) has the molecular formula C20H19N5O4S3 and a molecular weight of 489.60 g/mol. Its IUPAC name is 6-[4-[(2-thiophen-3-yl-1,3-thiazol-4-yl)methyl]piperazin-1-yl]sulfonyl-1,4-dihydroquinoxaline-2,3-dione.
| Compound Name | 6-[4-[(2-thiophen-3-yl-1,3-thiazol-4-yl)methyl]piperazin-1-yl]sulfonyl-1,4-dihydroquinoxaline-2,3-dione |
|---|---|
| PubChem CID | 24656784 |
| Molecular Formula | C20H19N5O4S3 |
| Molecular Weight | 489.60 g/mol |
| Exact Mass | 489.06 |
| IUPAC Name | 6-[4-[(2-thiophen-3-yl-1,3-thiazol-4-yl)methyl]piperazin-1-yl]sulfonyl-1,4-dihydroquinoxaline-2,3-dione |
| SMILES | O=c1[nH]c2ccc(S(=O)(=O)N3CCN(Cc4csc(-c5ccsc5)n4)CC3)cc2[nH]c1=O |
| InChI | InChI=1S/C20H19N5O4S3/c26-18-19(27)23-17-9-15(1-2-16(17)22-18)32(28,29)25-6-4-24(5-7-25)10-14-12-31-20(21-14)13-3-8-30-11-13/h1-3,8-9,11-12H,4-7,10H2,(H,22,26)(H,23,27) |
| InChIKey | KAQDAYQFDNPCBP-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 119.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.60 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|