C17H11N3O4S2 — CID 8888083
(2-thiophen-3-yl-1,3-thiazol-4-yl)methyl 2,3-dioxo-1,4-dihydroquinoxaline-6-carboxylate (PubChem CID 8888083) has the molecular formula C17H11N3O4S2 and a molecular weight of 385.43 g/mol. Its IUPAC name is (2-thiophen-3-yl-1,3-thiazol-4-yl)methyl 2,3-dioxo-1,4-dihydroquinoxaline-6-carboxylate.
| Compound Name | (2-thiophen-3-yl-1,3-thiazol-4-yl)methyl 2,3-dioxo-1,4-dihydroquinoxaline-6-carboxylate |
|---|---|
| PubChem CID | 8888083 |
| Molecular Formula | C17H11N3O4S2 |
| Molecular Weight | 385.43 g/mol |
| Exact Mass | 385.02 |
| IUPAC Name | (2-thiophen-3-yl-1,3-thiazol-4-yl)methyl 2,3-dioxo-1,4-dihydroquinoxaline-6-carboxylate |
| SMILES | O=C(OCc1csc(-c2ccsc2)n1)c1ccc2[nH]c(=O)c(=O)[nH]c2c1 |
| InChI | InChI=1S/C17H11N3O4S2/c21-14-15(22)20-13-5-9(1-2-12(13)19-14)17(23)24-6-11-8-26-16(18-11)10-3-4-25-7-10/h1-5,7-8H,6H2,(H,19,21)(H,20,22) |
| InChIKey | SNCDSIOYTNIHNI-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 104.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.43 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|