C16H13NO4S3 — CID 18203452
(2-thiophen-3-yl-1,3-thiazol-4-yl)methyl 3-methylsulfonylbenzoate (PubChem CID 18203452) has the molecular formula C16H13NO4S3 and a molecular weight of 379.48 g/mol. Its IUPAC name is (2-thiophen-3-yl-1,3-thiazol-4-yl)methyl 3-methylsulfonylbenzoate.
| Compound Name | (2-thiophen-3-yl-1,3-thiazol-4-yl)methyl 3-methylsulfonylbenzoate |
|---|---|
| PubChem CID | 18203452 |
| Molecular Formula | C16H13NO4S3 |
| Molecular Weight | 379.48 g/mol |
| Exact Mass | 379.00 |
| IUPAC Name | (2-thiophen-3-yl-1,3-thiazol-4-yl)methyl 3-methylsulfonylbenzoate |
| SMILES | CS(=O)(=O)c1cccc(C(=O)OCc2csc(-c3ccsc3)n2)c1 |
| InChI | InChI=1S/C16H13NO4S3/c1-24(19,20)14-4-2-3-11(7-14)16(18)21-8-13-10-23-15(17-13)12-5-6-22-9-12/h2-7,9-10H,8H2,1H3 |
| InChIKey | RZTSCKFCYANYQX-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 73.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.48 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |