C24H20N2O4S2 — CID 25039398
(2-phenyl-1,3-thiazol-4-yl)methyl 3-[(4-methylphenyl)sulfamoyl]benzoate (PubChem CID 25039398) has the molecular formula C24H20N2O4S2 and a molecular weight of 464.57 g/mol. Its IUPAC name is (2-phenyl-1,3-thiazol-4-yl)methyl 3-[(4-methylphenyl)sulfamoyl]benzoate.
| Compound Name | (2-phenyl-1,3-thiazol-4-yl)methyl 3-[(4-methylphenyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 25039398 |
| Molecular Formula | C24H20N2O4S2 |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.09 |
| IUPAC Name | (2-phenyl-1,3-thiazol-4-yl)methyl 3-[(4-methylphenyl)sulfamoyl]benzoate |
| SMILES | Cc1ccc(NS(=O)(=O)c2cccc(C(=O)OCc3csc(-c4ccccc4)n3)c2)cc1 |
| InChI | InChI=1S/C24H20N2O4S2/c1-17-10-12-20(13-11-17)26-32(28,29)22-9-5-8-19(14-22)24(27)30-15-21-16-31-23(25-21)18-6-3-2-4-7-18/h2-14,16,26H,15H2,1H3 |
| InChIKey | VBEJKBZKJZMGTG-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |