C23H17ClN2O4S2 — CID 25038213
(2-phenyl-1,3-thiazol-4-yl)methyl 3-[(2-chlorophenyl)sulfamoyl]benzoate (PubChem CID 25038213) has the molecular formula C23H17ClN2O4S2 and a molecular weight of 484.99 g/mol. Its IUPAC name is (2-phenyl-1,3-thiazol-4-yl)methyl 3-[(2-chlorophenyl)sulfamoyl]benzoate.
| Compound Name | (2-phenyl-1,3-thiazol-4-yl)methyl 3-[(2-chlorophenyl)sulfamoyl]benzoate |
|---|---|
| PubChem CID | 25038213 |
| Molecular Formula | C23H17ClN2O4S2 |
| Molecular Weight | 484.99 g/mol |
| Exact Mass | 484.03 |
| IUPAC Name | (2-phenyl-1,3-thiazol-4-yl)methyl 3-[(2-chlorophenyl)sulfamoyl]benzoate |
| SMILES | O=C(OCc1csc(-c2ccccc2)n1)c1cccc(S(=O)(=O)Nc2ccccc2Cl)c1 |
| InChI | InChI=1S/C23H17ClN2O4S2/c24-20-11-4-5-12-21(20)26-32(28,29)19-10-6-9-17(13-19)23(27)30-14-18-15-31-22(25-18)16-7-2-1-3-8-16/h1-13,15,26H,14H2 |
| InChIKey | ZATOTKOGSAPATQ-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.99 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |