C18H12F3NO2S — CID 7860078
(2-phenyl-1,3-thiazol-4-yl)methyl 3-(trifluoromethyl)benzoate (PubChem CID 7860078) has the molecular formula C18H12F3NO2S and a molecular weight of 363.36 g/mol. Its IUPAC name is (2-phenyl-1,3-thiazol-4-yl)methyl 3-(trifluoromethyl)benzoate.
| Compound Name | (2-phenyl-1,3-thiazol-4-yl)methyl 3-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 7860078 |
| Molecular Formula | C18H12F3NO2S |
| Molecular Weight | 363.36 g/mol |
| Exact Mass | 363.05 |
| IUPAC Name | (2-phenyl-1,3-thiazol-4-yl)methyl 3-(trifluoromethyl)benzoate |
| SMILES | O=C(OCc1csc(-c2ccccc2)n1)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C18H12F3NO2S/c19-18(20,21)14-8-4-7-13(9-14)17(23)24-10-15-11-25-16(22-15)12-5-2-1-3-6-12/h1-9,11H,10H2 |
| InChIKey | LEZCDTOGHOVXAK-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.36 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |