C18H16N2O4S2 — CID 4797377
(2-phenyl-1,3-thiazol-4-yl)methyl 2-(benzenesulfonamido)acetate (PubChem CID 4797377) has the molecular formula C18H16N2O4S2 and a molecular weight of 388.47 g/mol. Its IUPAC name is (2-phenyl-1,3-thiazol-4-yl)methyl 2-(benzenesulfonamido)acetate.
| Compound Name | (2-phenyl-1,3-thiazol-4-yl)methyl 2-(benzenesulfonamido)acetate |
|---|---|
| PubChem CID | 4797377 |
| Molecular Formula | C18H16N2O4S2 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.06 |
| IUPAC Name | (2-phenyl-1,3-thiazol-4-yl)methyl 2-(benzenesulfonamido)acetate |
| SMILES | O=C(CNS(=O)(=O)c1ccccc1)OCc1csc(-c2ccccc2)n1 |
| InChI | InChI=1S/C18H16N2O4S2/c21-17(11-19-26(22,23)16-9-5-2-6-10-16)24-12-15-13-25-18(20-15)14-7-3-1-4-8-14/h1-10,13,19H,11-12H2 |
| InChIKey | AJABNWVREHOXSG-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |