C30H25BrNO2PS — CID 164942759
(2-phenyl-1,3-thiazol-4-yl)methyl 2-[bromo(triphenyl)-λ5-phosphanyl]acetate (PubChem CID 164942759) has the molecular formula C30H25BrNO2PS and a molecular weight of 574.48 g/mol. Its IUPAC name is (2-phenyl-1,3-thiazol-4-yl)methyl 2-[bromo(triphenyl)-λ5-phosphanyl]acetate.
| Compound Name | (2-phenyl-1,3-thiazol-4-yl)methyl 2-[bromo(triphenyl)-λ5-phosphanyl]acetate |
|---|---|
| PubChem CID | 164942759 |
| Molecular Formula | C30H25BrNO2PS |
| Molecular Weight | 574.48 g/mol |
| Exact Mass | 573.05 |
| IUPAC Name | (2-phenyl-1,3-thiazol-4-yl)methyl 2-[bromo(triphenyl)-λ5-phosphanyl]acetate |
| SMILES | O=C(CP(Br)(c1ccccc1)(c1ccccc1)c1ccccc1)OCc1csc(-c2ccccc2)n1 |
| InChI | InChI=1S/C30H25BrNO2PS/c31-35(26-15-7-2-8-16-26,27-17-9-3-10-18-27,28-19-11-4-12-20-28)22-29(33)34-21-25-23-36-30(32-25)24-13-5-1-6-14-24/h1-20,23H,21-22H2 |
| InChIKey | AWSUTGRYRUJLFL-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.48 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|