C22H23NO5S — CID 7776265
(2-phenyl-1,3-thiazol-4-yl)methyl 3-(3,4,5-trimethoxyphenyl)propanoate (PubChem CID 7776265) has the molecular formula C22H23NO5S and a molecular weight of 413.50 g/mol. Its IUPAC name is (2-phenyl-1,3-thiazol-4-yl)methyl 3-(3,4,5-trimethoxyphenyl)propanoate.
| Compound Name | (2-phenyl-1,3-thiazol-4-yl)methyl 3-(3,4,5-trimethoxyphenyl)propanoate |
|---|---|
| PubChem CID | 7776265 |
| Molecular Formula | C22H23NO5S |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | (2-phenyl-1,3-thiazol-4-yl)methyl 3-(3,4,5-trimethoxyphenyl)propanoate |
| SMILES | COc1cc(CCC(=O)OCc2csc(-c3ccccc3)n2)cc(OC)c1OC |
| InChI | InChI=1S/C22H23NO5S/c1-25-18-11-15(12-19(26-2)21(18)27-3)9-10-20(24)28-13-17-14-29-22(23-17)16-7-5-4-6-8-16/h4-8,11-12,14H,9-10,13H2,1-3H3 |
| InChIKey | CXRGLPXETWFIPC-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 66.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |