C21H20N2O4S2 — CID 30811015
[2-(4-methylphenyl)-1,3-thiazol-4-yl]methyl 4-(cyclopropylsulfamoyl)benzoate (PubChem CID 30811015) has the molecular formula C21H20N2O4S2 and a molecular weight of 428.54 g/mol. Its IUPAC name is [2-(4-methylphenyl)-1,3-thiazol-4-yl]methyl 4-(cyclopropylsulfamoyl)benzoate.
| Compound Name | [2-(4-methylphenyl)-1,3-thiazol-4-yl]methyl 4-(cyclopropylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 30811015 |
| Molecular Formula | C21H20N2O4S2 |
| Molecular Weight | 428.54 g/mol |
| Exact Mass | 428.09 |
| IUPAC Name | [2-(4-methylphenyl)-1,3-thiazol-4-yl]methyl 4-(cyclopropylsulfamoyl)benzoate |
| SMILES | Cc1ccc(-c2nc(COC(=O)c3ccc(S(=O)(=O)NC4CC4)cc3)cs2)cc1 |
| InChI | InChI=1S/C21H20N2O4S2/c1-14-2-4-15(5-3-14)20-22-18(13-28-20)12-27-21(24)16-6-10-19(11-7-16)29(25,26)23-17-8-9-17/h2-7,10-11,13,17,23H,8-9,12H2,1H3 |
| InChIKey | ULAPBQISPVSBQV-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.54 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |