C20H19NO3S — CID 7866808
[2-(4-propan-2-ylphenyl)-1,3-thiazol-4-yl]methyl 4-hydroxybenzoate (PubChem CID 7866808) has the molecular formula C20H19NO3S and a molecular weight of 353.44 g/mol. Its IUPAC name is [2-(4-propan-2-ylphenyl)-1,3-thiazol-4-yl]methyl 4-hydroxybenzoate.
| Compound Name | [2-(4-propan-2-ylphenyl)-1,3-thiazol-4-yl]methyl 4-hydroxybenzoate |
|---|---|
| PubChem CID | 7866808 |
| Molecular Formula | C20H19NO3S |
| Molecular Weight | 353.44 g/mol |
| Exact Mass | 353.11 |
| IUPAC Name | [2-(4-propan-2-ylphenyl)-1,3-thiazol-4-yl]methyl 4-hydroxybenzoate |
| SMILES | CC(C)c1ccc(-c2nc(COC(=O)c3ccc(O)cc3)cs2)cc1 |
| InChI | InChI=1S/C20H19NO3S/c1-13(2)14-3-5-15(6-4-14)19-21-17(12-25-19)11-24-20(23)16-7-9-18(22)10-8-16/h3-10,12-13,22H,11H2,1-2H3 |
| InChIKey | ODNVWPFHFFDMPA-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.44 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |