C16H16N2O2S — CID 7804997
cyanomethyl 2-[2-(4-propan-2-ylphenyl)-1,3-thiazol-4-yl]acetate (PubChem CID 7804997) has the molecular formula C16H16N2O2S and a molecular weight of 300.38 g/mol. Its IUPAC name is cyanomethyl 2-[2-(4-propan-2-ylphenyl)-1,3-thiazol-4-yl]acetate.
| Compound Name | cyanomethyl 2-[2-(4-propan-2-ylphenyl)-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 7804997 |
| Molecular Formula | C16H16N2O2S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | cyanomethyl 2-[2-(4-propan-2-ylphenyl)-1,3-thiazol-4-yl]acetate |
| SMILES | CC(C)c1ccc(-c2nc(CC(=O)OCC#N)cs2)cc1 |
| InChI | InChI=1S/C16H16N2O2S/c1-11(2)12-3-5-13(6-4-12)16-18-14(10-21-16)9-15(19)20-8-7-17/h3-6,10-11H,8-9H2,1-2H3 |
| InChIKey | DPGABQCYEQZFDE-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 62.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |