C14H15NO2S2 — CID 106847709
methyl 2-[2-(4-ethylsulfanylphenyl)-1,3-thiazol-4-yl]acetate (PubChem CID 106847709) has the molecular formula C14H15NO2S2 and a molecular weight of 293.41 g/mol. Its IUPAC name is methyl 2-[2-(4-ethylsulfanylphenyl)-1,3-thiazol-4-yl]acetate.
| Compound Name | methyl 2-[2-(4-ethylsulfanylphenyl)-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 106847709 |
| Molecular Formula | C14H15NO2S2 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.05 |
| IUPAC Name | methyl 2-[2-(4-ethylsulfanylphenyl)-1,3-thiazol-4-yl]acetate |
| SMILES | CCSc1ccc(-c2nc(CC(=O)OC)cs2)cc1 |
| InChI | InChI=1S/C14H15NO2S2/c1-3-18-12-6-4-10(5-7-12)14-15-11(9-19-14)8-13(16)17-2/h4-7,9H,3,8H2,1-2H3 |
| InChIKey | DCPADXLGBGDJHP-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |