C15H12N2O2S — CID 80574366
methyl 2-(2-quinolin-6-yl-1,3-thiazol-4-yl)acetate (PubChem CID 80574366) has the molecular formula C15H12N2O2S and a molecular weight of 284.34 g/mol. Its IUPAC name is methyl 2-(2-quinolin-6-yl-1,3-thiazol-4-yl)acetate.
| Compound Name | methyl 2-(2-quinolin-6-yl-1,3-thiazol-4-yl)acetate |
|---|---|
| PubChem CID | 80574366 |
| Molecular Formula | C15H12N2O2S |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | methyl 2-(2-quinolin-6-yl-1,3-thiazol-4-yl)acetate |
| SMILES | COC(=O)Cc1csc(-c2ccc3ncccc3c2)n1 |
| InChI | InChI=1S/C15H12N2O2S/c1-19-14(18)8-12-9-20-15(17-12)11-4-5-13-10(7-11)3-2-6-16-13/h2-7,9H,8H2,1H3 |
| InChIKey | TXVQSCMRZBRODB-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |