About methyl 4-quinolin-6-ylbutanoate
methyl 4-quinolin-6-ylbutanoate (PubChem CID 116997352) has the molecular formula C14H15NO2
and a molecular weight of 229.28 g/mol. Its IUPAC name is methyl 4-quinolin-6-ylbutanoate.
Molecular Properties
| Compound Name | methyl 4-quinolin-6-ylbutanoate |
| PubChem CID | 116997352 |
| Molecular Formula | C14H15NO2 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | methyl 4-quinolin-6-ylbutanoate |
| SMILES | COC(=O)CCCc1ccc2ncccc2c1 |
| InChI | InChI=1S/C14H15NO2/c1-17-14(16)6-2-4-11-7-8-13-12(10-11)5-3-9-15-13/h3,5,7-10H,2,4,6H2,1H3 |
| InChIKey | PRIMCXWOAOKGMA-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 4-quinolin-6-ylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-quinolin-6-ylbutanoate?
The IUPAC name of methyl 4-quinolin-6-ylbutanoate (CID 116997352) is methyl 4-quinolin-6-ylbutanoate.
What is the SMILES notation for methyl 4-quinolin-6-ylbutanoate?
The canonical SMILES for methyl 4-quinolin-6-ylbutanoate is COC(=O)CCCc1ccc2ncccc2c1.
What is the InChIKey of methyl 4-quinolin-6-ylbutanoate?
The InChIKey is PRIMCXWOAOKGMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15NO2/c1-17-14(16)6-2-4-11-7-8-13-12(10-11)5-3-9-15-13/h3,5,7-10H,2,4,6H2,1H3.
What are the key properties of methyl 4-quinolin-6-ylbutanoate?
methyl 4-quinolin-6-ylbutanoate has a molecular weight of 229.28 g/mol, XLogP of 2.73, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-quinolin-6-ylbutanoate is sourced from PubChem (CID 116997352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).