C19H16ClN3O3S — CID 8815602
[2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] 2-[2-(4-methylphenyl)-1,3-thiazol-4-yl]acetate (PubChem CID 8815602) has the molecular formula C19H16ClN3O3S and a molecular weight of 401.88 g/mol. Its IUPAC name is [2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] 2-[2-(4-methylphenyl)-1,3-thiazol-4-yl]acetate.
| Compound Name | [2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] 2-[2-(4-methylphenyl)-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 8815602 |
| Molecular Formula | C19H16ClN3O3S |
| Molecular Weight | 401.88 g/mol |
| Exact Mass | 401.06 |
| IUPAC Name | [2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] 2-[2-(4-methylphenyl)-1,3-thiazol-4-yl]acetate |
| SMILES | Cc1ccc(-c2nc(CC(=O)OCC(=O)Nc3cccnc3Cl)cs2)cc1 |
| InChI | InChI=1S/C19H16ClN3O3S/c1-12-4-6-13(7-5-12)19-22-14(11-27-19)9-17(25)26-10-16(24)23-15-3-2-8-21-18(15)20/h2-8,11H,9-10H2,1H3,(H,23,24) |
| InChIKey | UBOGJRJJGPHKKV-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.88 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|