C10H10N2O2S — CID 136988898
methyl 2-[2-(1H-pyrrol-3-yl)-1,3-thiazol-4-yl]acetate (PubChem CID 136988898) has the molecular formula C10H10N2O2S and a molecular weight of 222.27 g/mol. Its IUPAC name is methyl 2-[2-(1H-pyrrol-3-yl)-1,3-thiazol-4-yl]acetate.
| Compound Name | methyl 2-[2-(1H-pyrrol-3-yl)-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 136988898 |
| Molecular Formula | C10H10N2O2S |
| Molecular Weight | 222.27 g/mol |
| Exact Mass | 222.05 |
| IUPAC Name | methyl 2-[2-(1H-pyrrol-3-yl)-1,3-thiazol-4-yl]acetate |
| SMILES | COC(=O)Cc1csc(-c2cc[nH]c2)n1 |
| InChI | InChI=1S/C10H10N2O2S/c1-14-9(13)4-8-6-15-10(12-8)7-2-3-11-5-7/h2-3,5-6,11H,4H2,1H3 |
| InChIKey | ZXJYNLPLBOHAPS-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.27 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |