C8H8N2OS — CID 136988851
[2-(1H-pyrrol-3-yl)-1,3-thiazol-4-yl]methanol (PubChem CID 136988851) has the molecular formula C8H8N2OS and a molecular weight of 180.23 g/mol. Its IUPAC name is [2-(1H-pyrrol-3-yl)-1,3-thiazol-4-yl]methanol.
| Compound Name | [2-(1H-pyrrol-3-yl)-1,3-thiazol-4-yl]methanol |
|---|---|
| PubChem CID | 136988851 |
| Molecular Formula | C8H8N2OS |
| Molecular Weight | 180.23 g/mol |
| Exact Mass | 180.04 |
| IUPAC Name | [2-(1H-pyrrol-3-yl)-1,3-thiazol-4-yl]methanol |
| SMILES | OCc1csc(-c2cc[nH]c2)n1 |
| InChI | InChI=1S/C8H8N2OS/c11-4-7-5-12-8(10-7)6-1-2-9-3-6/h1-3,5,9,11H,4H2 |
| InChIKey | BUAQVXZQFZNWLO-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.23 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |