C13H17N3S — CID 136988832
4-(piperidin-4-ylmethyl)-2-(1H-pyrrol-3-yl)-1,3-thiazole (PubChem CID 136988832) has the molecular formula C13H17N3S and a molecular weight of 247.37 g/mol. Its IUPAC name is 4-(piperidin-4-ylmethyl)-2-(1H-pyrrol-3-yl)-1,3-thiazole.
| Compound Name | 4-(piperidin-4-ylmethyl)-2-(1H-pyrrol-3-yl)-1,3-thiazole |
|---|---|
| PubChem CID | 136988832 |
| Molecular Formula | C13H17N3S |
| Molecular Weight | 247.37 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | 4-(piperidin-4-ylmethyl)-2-(1H-pyrrol-3-yl)-1,3-thiazole |
| SMILES | c1cc(-c2nc(CC3CCNCC3)cs2)c[nH]1 |
| InChI | InChI=1S/C13H17N3S/c1-4-14-5-2-10(1)7-12-9-17-13(16-12)11-3-6-15-8-11/h3,6,8-10,14-15H,1-2,4-5,7H2 |
| InChIKey | FZUJCYVNQAEXKM-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.37 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |