C11H16N2S — CID 82659962
2-cyclopropyl-4-(pyrrolidin-3-ylmethyl)-1,3-thiazole (PubChem CID 82659962) has the molecular formula C11H16N2S and a molecular weight of 208.33 g/mol. Its IUPAC name is 2-cyclopropyl-4-(pyrrolidin-3-ylmethyl)-1,3-thiazole.
| Compound Name | 2-cyclopropyl-4-(pyrrolidin-3-ylmethyl)-1,3-thiazole |
|---|---|
| PubChem CID | 82659962 |
| Molecular Formula | C11H16N2S |
| Molecular Weight | 208.33 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | 2-cyclopropyl-4-(pyrrolidin-3-ylmethyl)-1,3-thiazole |
| SMILES | c1sc(C2CC2)nc1CC1CCNC1 |
| InChI | InChI=1S/C11H16N2S/c1-2-9(1)11-13-10(7-14-11)5-8-3-4-12-6-8/h7-9,12H,1-6H2 |
| InChIKey | XAJMBCBLVQTKFL-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.33 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |