C11H19ClN2OS — CID 120558226
4-(ethoxymethyl)-2-piperidin-4-yl-1,3-thiazole;hydrochloride (PubChem CID 120558226) has the molecular formula C11H19ClN2OS and a molecular weight of 262.81 g/mol. Its IUPAC name is 4-(ethoxymethyl)-2-piperidin-4-yl-1,3-thiazole;hydrochloride.
| Compound Name | 4-(ethoxymethyl)-2-piperidin-4-yl-1,3-thiazole;hydrochloride |
|---|---|
| PubChem CID | 120558226 |
| Molecular Formula | C11H19ClN2OS |
| Molecular Weight | 262.81 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | 4-(ethoxymethyl)-2-piperidin-4-yl-1,3-thiazole;hydrochloride |
| SMILES | CCOCc1csc(C2CCNCC2)n1.Cl |
| InChI | InChI=1S/C11H18N2OS.ClH/c1-2-14-7-10-8-15-11(13-10)9-3-5-12-6-4-9;/h8-9,12H,2-7H2,1H3;1H |
| InChIKey | FDPGPRQJRQFVGM-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.81 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |