About methyl 3-methyl-2-[2-(1H-pyrrol-3-yl)-1,3-thiazol-4-yl]butanoate
methyl 3-methyl-2-[2-(1H-pyrrol-3-yl)-1,3-thiazol-4-yl]butanoate (PubChem CID 136989001) has the molecular formula C13H16N2O2S
and a molecular weight of 264.35 g/mol. Its IUPAC name is methyl 3-methyl-2-[2-(1H-pyrrol-3-yl)-1,3-thiazol-4-yl]butanoate.
Molecular Properties
| Compound Name | methyl 3-methyl-2-[2-(1H-pyrrol-3-yl)-1,3-thiazol-4-yl]butanoate |
| PubChem CID | 136989001 |
| Molecular Formula | C13H16N2O2S |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | methyl 3-methyl-2-[2-(1H-pyrrol-3-yl)-1,3-thiazol-4-yl]butanoate |
| SMILES | COC(=O)C(c1csc(-c2cc[nH]c2)n1)C(C)C |
| InChI | InChI=1S/C13H16N2O2S/c1-8(2)11(13(16)17-3)10-7-18-12(15-10)9-4-5-14-6-9/h4-8,11,14H,1-3H3 |
| InChIKey | OGDAJJVMYFCFQP-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 3-methyl-2-[2-(1H-pyrrol-3-yl)-1,3-thiazol-4-yl]butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-methyl-2-[2-(1H-pyrrol-3-yl)-1,3-thiazol-4-yl]butanoate?
The IUPAC name of methyl 3-methyl-2-[2-(1H-pyrrol-3-yl)-1,3-thiazol-4-yl]butanoate (CID 136989001) is methyl 3-methyl-2-[2-(1H-pyrrol-3-yl)-1,3-thiazol-4-yl]butanoate.
What is the SMILES notation for methyl 3-methyl-2-[2-(1H-pyrrol-3-yl)-1,3-thiazol-4-yl]butanoate?
The canonical SMILES for methyl 3-methyl-2-[2-(1H-pyrrol-3-yl)-1,3-thiazol-4-yl]butanoate is COC(=O)C(c1csc(-c2cc[nH]c2)n1)C(C)C.
What is the InChIKey of methyl 3-methyl-2-[2-(1H-pyrrol-3-yl)-1,3-thiazol-4-yl]butanoate?
The InChIKey is OGDAJJVMYFCFQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2O2S/c1-8(2)11(13(16)17-3)10-7-18-12(15-10)9-4-5-14-6-9/h4-8,11,14H,1-3H3.
What are the key properties of methyl 3-methyl-2-[2-(1H-pyrrol-3-yl)-1,3-thiazol-4-yl]butanoate?
methyl 3-methyl-2-[2-(1H-pyrrol-3-yl)-1,3-thiazol-4-yl]butanoate has a molecular weight of 264.35 g/mol, XLogP of 3.05, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-methyl-2-[2-(1H-pyrrol-3-yl)-1,3-thiazol-4-yl]butanoate is sourced from PubChem (CID 136989001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).