C12H16N2OS — CID 116967340
3-methyl-2-[4-(1H-pyrrol-3-yl)-1,3-thiazol-2-yl]butan-1-ol (PubChem CID 116967340) has the molecular formula C12H16N2OS and a molecular weight of 236.34 g/mol. Its IUPAC name is 3-methyl-2-[4-(1H-pyrrol-3-yl)-1,3-thiazol-2-yl]butan-1-ol.
| Compound Name | 3-methyl-2-[4-(1H-pyrrol-3-yl)-1,3-thiazol-2-yl]butan-1-ol |
|---|---|
| PubChem CID | 116967340 |
| Molecular Formula | C12H16N2OS |
| Molecular Weight | 236.34 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | 3-methyl-2-[4-(1H-pyrrol-3-yl)-1,3-thiazol-2-yl]butan-1-ol |
| SMILES | CC(C)C(CO)c1nc(-c2cc[nH]c2)cs1 |
| InChI | InChI=1S/C12H16N2OS/c1-8(2)10(6-15)12-14-11(7-16-12)9-3-4-13-5-9/h3-5,7-8,10,13,15H,6H2,1-2H3 |
| InChIKey | JMIXYLSCTAALQY-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.34 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |