C8H9N3S — CID 82280712
[4-(1H-pyrrol-3-yl)-1,3-thiazol-2-yl]methanamine (PubChem CID 82280712) has the molecular formula C8H9N3S and a molecular weight of 179.25 g/mol. Its IUPAC name is [4-(1H-pyrrol-3-yl)-1,3-thiazol-2-yl]methanamine.
| Compound Name | [4-(1H-pyrrol-3-yl)-1,3-thiazol-2-yl]methanamine |
|---|---|
| PubChem CID | 82280712 |
| Molecular Formula | C8H9N3S |
| Molecular Weight | 179.25 g/mol |
| Exact Mass | 179.05 |
| IUPAC Name | [4-(1H-pyrrol-3-yl)-1,3-thiazol-2-yl]methanamine |
| SMILES | NCc1nc(-c2cc[nH]c2)cs1 |
| InChI | InChI=1S/C8H9N3S/c9-3-8-11-7(5-12-8)6-1-2-10-4-6/h1-2,4-5,10H,3,9H2 |
| InChIKey | WPHRFSIXFKAPBC-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.25 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |