C8H5F3N2S — CID 116967685
4-(1H-pyrrol-3-yl)-2-(trifluoromethyl)-1,3-thiazole (PubChem CID 116967685) has the molecular formula C8H5F3N2S and a molecular weight of 218.20 g/mol. Its IUPAC name is 4-(1H-pyrrol-3-yl)-2-(trifluoromethyl)-1,3-thiazole.
| Compound Name | 4-(1H-pyrrol-3-yl)-2-(trifluoromethyl)-1,3-thiazole |
|---|---|
| PubChem CID | 116967685 |
| Molecular Formula | C8H5F3N2S |
| Molecular Weight | 218.20 g/mol |
| Exact Mass | 218.01 |
| IUPAC Name | 4-(1H-pyrrol-3-yl)-2-(trifluoromethyl)-1,3-thiazole |
| SMILES | FC(F)(F)c1nc(-c2cc[nH]c2)cs1 |
| InChI | InChI=1S/C8H5F3N2S/c9-8(10,11)7-13-6(4-14-7)5-1-2-12-3-5/h1-4,12H |
| InChIKey | WPVQJNCJTWXUFP-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.20 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |