C10H5BrF3NS — CID 112700792
4-(2-bromophenyl)-2-(trifluoromethyl)-1,3-thiazole (PubChem CID 112700792) has the molecular formula C10H5BrF3NS and a molecular weight of 308.12 g/mol. Its IUPAC name is 4-(2-bromophenyl)-2-(trifluoromethyl)-1,3-thiazole.
| Compound Name | 4-(2-bromophenyl)-2-(trifluoromethyl)-1,3-thiazole |
|---|---|
| PubChem CID | 112700792 |
| Molecular Formula | C10H5BrF3NS |
| Molecular Weight | 308.12 g/mol |
| Exact Mass | 306.93 |
| IUPAC Name | 4-(2-bromophenyl)-2-(trifluoromethyl)-1,3-thiazole |
| SMILES | FC(F)(F)c1nc(-c2ccccc2Br)cs1 |
| InChI | InChI=1S/C10H5BrF3NS/c11-7-4-2-1-3-6(7)8-5-16-9(15-8)10(12,13)14/h1-5H |
| InChIKey | FNBXDJLLODAACB-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.12 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |