C8H4F3NS2 — CID 116967666
4-thiophen-2-yl-2-(trifluoromethyl)-1,3-thiazole (PubChem CID 116967666) has the molecular formula C8H4F3NS2 and a molecular weight of 235.26 g/mol. Its IUPAC name is 4-thiophen-2-yl-2-(trifluoromethyl)-1,3-thiazole.
| Compound Name | 4-thiophen-2-yl-2-(trifluoromethyl)-1,3-thiazole |
|---|---|
| PubChem CID | 116967666 |
| Molecular Formula | C8H4F3NS2 |
| Molecular Weight | 235.26 g/mol |
| Exact Mass | 234.97 |
| IUPAC Name | 4-thiophen-2-yl-2-(trifluoromethyl)-1,3-thiazole |
| SMILES | FC(F)(F)c1nc(-c2cccs2)cs1 |
| InChI | InChI=1S/C8H4F3NS2/c9-8(10,11)7-12-5(4-14-7)6-2-1-3-13-6/h1-4H |
| InChIKey | AZDROAKYTPQHHT-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.26 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |