C10H11NS3 — CID 116968907
3-(4-thiophen-2-yl-1,3-thiazol-2-yl)propane-1-thiol (PubChem CID 116968907) has the molecular formula C10H11NS3 and a molecular weight of 241.41 g/mol. Its IUPAC name is 3-(4-thiophen-2-yl-1,3-thiazol-2-yl)propane-1-thiol.
| Compound Name | 3-(4-thiophen-2-yl-1,3-thiazol-2-yl)propane-1-thiol |
|---|---|
| PubChem CID | 116968907 |
| Molecular Formula | C10H11NS3 |
| Molecular Weight | 241.41 g/mol |
| Exact Mass | 241.01 |
| IUPAC Name | 3-(4-thiophen-2-yl-1,3-thiazol-2-yl)propane-1-thiol |
| SMILES | SCCCc1nc(-c2cccs2)cs1 |
| InChI | InChI=1S/C10H11NS3/c12-5-1-4-10-11-8(7-14-10)9-3-2-6-13-9/h2-3,6-7,12H,1,4-5H2 |
| InChIKey | LZSPKRFNJHOMFY-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 12.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.41 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|