C11H13NOS2 — CID 82117281
2-methyl-3-(4-thiophen-2-yl-1,3-thiazol-2-yl)propan-1-ol (PubChem CID 82117281) has the molecular formula C11H13NOS2 and a molecular weight of 239.36 g/mol. Its IUPAC name is 2-methyl-3-(4-thiophen-2-yl-1,3-thiazol-2-yl)propan-1-ol.
| Compound Name | 2-methyl-3-(4-thiophen-2-yl-1,3-thiazol-2-yl)propan-1-ol |
|---|---|
| PubChem CID | 82117281 |
| Molecular Formula | C11H13NOS2 |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.04 |
| IUPAC Name | 2-methyl-3-(4-thiophen-2-yl-1,3-thiazol-2-yl)propan-1-ol |
| SMILES | CC(CO)Cc1nc(-c2cccs2)cs1 |
| InChI | InChI=1S/C11H13NOS2/c1-8(6-13)5-11-12-9(7-15-11)10-3-2-4-14-10/h2-4,7-8,13H,5-6H2,1H3 |
| InChIKey | CANBMWCUNTVFKT-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |