C9H8N2OS2 — CID 9173961
2-(4-thiophen-2-yl-1,3-thiazol-2-yl)acetamide (PubChem CID 9173961) has the molecular formula C9H8N2OS2 and a molecular weight of 224.31 g/mol. Its IUPAC name is 2-(4-thiophen-2-yl-1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-(4-thiophen-2-yl-1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 9173961 |
| Molecular Formula | C9H8N2OS2 |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.01 |
| IUPAC Name | 2-(4-thiophen-2-yl-1,3-thiazol-2-yl)acetamide |
| SMILES | NC(=O)Cc1nc(-c2cccs2)cs1 |
| InChI | InChI=1S/C9H8N2OS2/c10-8(12)4-9-11-6(5-14-9)7-2-1-3-13-7/h1-3,5H,4H2,(H2,10,12) |
| InChIKey | IPYSPYXJEOLECT-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |