C5H7N3OS — CID 130787595
2-(4-amino-1,3-thiazol-2-yl)acetamide (PubChem CID 130787595) has the molecular formula C5H7N3OS and a molecular weight of 157.20 g/mol. Its IUPAC name is 2-(4-amino-1,3-thiazol-2-yl)acetamide.
| Compound Name | 2-(4-amino-1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 130787595 |
| Molecular Formula | C5H7N3OS |
| Molecular Weight | 157.20 g/mol |
| Exact Mass | 157.03 |
| IUPAC Name | 2-(4-amino-1,3-thiazol-2-yl)acetamide |
| SMILES | NC(=O)Cc1nc(N)cs1 |
| InChI | InChI=1S/C5H7N3OS/c6-3-2-10-5(8-3)1-4(7)9/h2H,1,6H2,(H2,7,9) |
| InChIKey | YKCGPSNSWAGJHA-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 82.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.20 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |