C8H13N3OS — CID 171049213
2-(4-amino-1,3-thiazol-2-yl)-N-propan-2-ylacetamide (PubChem CID 171049213) has the molecular formula C8H13N3OS and a molecular weight of 199.28 g/mol. Its IUPAC name is 2-(4-amino-1,3-thiazol-2-yl)-N-propan-2-ylacetamide.
| Compound Name | 2-(4-amino-1,3-thiazol-2-yl)-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 171049213 |
| Molecular Formula | C8H13N3OS |
| Molecular Weight | 199.28 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | 2-(4-amino-1,3-thiazol-2-yl)-N-propan-2-ylacetamide |
| SMILES | CC(C)NC(=O)Cc1nc(N)cs1 |
| InChI | InChI=1S/C8H13N3OS/c1-5(2)10-7(12)3-8-11-6(9)4-13-8/h4-5H,3,9H2,1-2H3,(H,10,12) |
| InChIKey | CPLIDSGAYJUPKC-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.28 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |