C8H12N4O2S — CID 62798707
2-[[2-(2-amino-1,3-thiazol-4-yl)acetyl]amino]propanamide (PubChem CID 62798707) has the molecular formula C8H12N4O2S and a molecular weight of 228.28 g/mol. Its IUPAC name is 2-[[2-(2-amino-1,3-thiazol-4-yl)acetyl]amino]propanamide.
| Compound Name | 2-[[2-(2-amino-1,3-thiazol-4-yl)acetyl]amino]propanamide |
|---|---|
| PubChem CID | 62798707 |
| Molecular Formula | C8H12N4O2S |
| Molecular Weight | 228.28 g/mol |
| Exact Mass | 228.07 |
| IUPAC Name | 2-[[2-(2-amino-1,3-thiazol-4-yl)acetyl]amino]propanamide |
| SMILES | CC(NC(=O)Cc1csc(N)n1)C(N)=O |
| InChI | InChI=1S/C8H12N4O2S/c1-4(7(9)14)11-6(13)2-5-3-15-8(10)12-5/h3-4H,2H2,1H3,(H2,9,14)(H2,10,12)(H,11,13) |
| InChIKey | YTKMDNYKZIMVTM-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 111.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.28 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |