C14H17N3O2S — CID 62799997
2-(2-amino-1,3-thiazol-4-yl)-N-[1-(2-methoxyphenyl)ethyl]acetamide (PubChem CID 62799997) has the molecular formula C14H17N3O2S and a molecular weight of 291.38 g/mol. Its IUPAC name is 2-(2-amino-1,3-thiazol-4-yl)-N-[1-(2-methoxyphenyl)ethyl]acetamide.
| Compound Name | 2-(2-amino-1,3-thiazol-4-yl)-N-[1-(2-methoxyphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 62799997 |
| Molecular Formula | C14H17N3O2S |
| Molecular Weight | 291.38 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | 2-(2-amino-1,3-thiazol-4-yl)-N-[1-(2-methoxyphenyl)ethyl]acetamide |
| SMILES | COc1ccccc1C(C)NC(=O)Cc1csc(N)n1 |
| InChI | InChI=1S/C14H17N3O2S/c1-9(11-5-3-4-6-12(11)19-2)16-13(18)7-10-8-20-14(15)17-10/h3-6,8-9H,7H2,1-2H3,(H2,15,17)(H,16,18) |
| InChIKey | NBGBIWFALCIXAC-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.38 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |