C10H16N4O2S — CID 106344945
2-[[2-(2-amino-1,3-thiazol-4-yl)acetyl]amino]-3-methylbutanamide (PubChem CID 106344945) has the molecular formula C10H16N4O2S and a molecular weight of 256.33 g/mol. Its IUPAC name is 2-[[2-(2-amino-1,3-thiazol-4-yl)acetyl]amino]-3-methylbutanamide.
| Compound Name | 2-[[2-(2-amino-1,3-thiazol-4-yl)acetyl]amino]-3-methylbutanamide |
|---|---|
| PubChem CID | 106344945 |
| Molecular Formula | C10H16N4O2S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | 2-[[2-(2-amino-1,3-thiazol-4-yl)acetyl]amino]-3-methylbutanamide |
| SMILES | CC(C)C(NC(=O)Cc1csc(N)n1)C(N)=O |
| InChI | InChI=1S/C10H16N4O2S/c1-5(2)8(9(11)16)14-7(15)3-6-4-17-10(12)13-6/h4-5,8H,3H2,1-2H3,(H2,11,16)(H2,12,13)(H,14,15) |
| InChIKey | LPNZBPMLDRSUDG-UHFFFAOYSA-N |
| XLogP | -0.11 |
| TPSA | 111.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |