C10H15N3O3S — CID 107564975
(2R)-2-[[2-(2-amino-1,3-thiazol-4-yl)acetyl]amino]pentanoic acid (PubChem CID 107564975) has the molecular formula C10H15N3O3S and a molecular weight of 257.31 g/mol. Its IUPAC name is (2R)-2-[[2-(2-amino-1,3-thiazol-4-yl)acetyl]amino]pentanoic acid.
| Compound Name | (2R)-2-[[2-(2-amino-1,3-thiazol-4-yl)acetyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 107564975 |
| Molecular Formula | C10H15N3O3S |
| Molecular Weight | 257.31 g/mol |
| Exact Mass | 257.08 |
| IUPAC Name | (2R)-2-[[2-(2-amino-1,3-thiazol-4-yl)acetyl]amino]pentanoic acid |
| SMILES | CCC[C@@H](NC(=O)Cc1csc(N)n1)C(=O)O |
| InChI | InChI=1S/C10H15N3O3S/c1-2-3-7(9(15)16)13-8(14)4-6-5-17-10(11)12-6/h5,7H,2-4H2,1H3,(H2,11,12)(H,13,14)(H,15,16)/t7-/m1/s1 |
| InChIKey | QBBLNRLFFOGGKI-SSDOTTSWSA-N |
| XLogP | 0.64 |
| TPSA | 105.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.31 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |