C10H13N3O5S — CID 62799107
(2S)-2-[[2-(2-amino-1,3-thiazol-4-yl)acetyl]amino]pentanedioic acid (PubChem CID 62799107) has the molecular formula C10H13N3O5S and a molecular weight of 287.30 g/mol. Its IUPAC name is (2S)-2-[[2-(2-amino-1,3-thiazol-4-yl)acetyl]amino]pentanedioic acid.
| Compound Name | (2S)-2-[[2-(2-amino-1,3-thiazol-4-yl)acetyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 62799107 |
| Molecular Formula | C10H13N3O5S |
| Molecular Weight | 287.30 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | (2S)-2-[[2-(2-amino-1,3-thiazol-4-yl)acetyl]amino]pentanedioic acid |
| SMILES | Nc1nc(CC(=O)N[C@@H](CCC(=O)O)C(=O)O)cs1 |
| InChI | InChI=1S/C10H13N3O5S/c11-10-12-5(4-19-10)3-7(14)13-6(9(17)18)1-2-8(15)16/h4,6H,1-3H2,(H2,11,12)(H,13,14)(H,15,16)(H,17,18)/t6-/m0/s1 |
| InChIKey | NWYZZPRIYVOZDD-LURJTMIESA-N |
| XLogP | -0.30 |
| TPSA | 142.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.30 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |