C6H7N3O2S — CID 56988029
2-(2-amino-1,3-thiazol-4-yl)-N-formylacetamide (PubChem CID 56988029) has the molecular formula C6H7N3O2S and a molecular weight of 185.21 g/mol. Its IUPAC name is 2-(2-amino-1,3-thiazol-4-yl)-N-formylacetamide.
| Compound Name | 2-(2-amino-1,3-thiazol-4-yl)-N-formylacetamide |
|---|---|
| PubChem CID | 56988029 |
| Molecular Formula | C6H7N3O2S |
| Molecular Weight | 185.21 g/mol |
| Exact Mass | 185.03 |
| IUPAC Name | 2-(2-amino-1,3-thiazol-4-yl)-N-formylacetamide |
| SMILES | Nc1nc(CC(=O)NC=O)cs1 |
| InChI | InChI=1S/C6H7N3O2S/c7-6-9-4(2-12-6)1-5(11)8-3-10/h2-3H,1H2,(H2,7,9)(H,8,10,11) |
| InChIKey | TVZGHZKXIWHQAE-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.21 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|