C8H13N3O2S — CID 62797982
2-(2-amino-1,3-thiazol-4-yl)-N-(3-hydroxypropyl)acetamide (PubChem CID 62797982) has the molecular formula C8H13N3O2S and a molecular weight of 215.28 g/mol. Its IUPAC name is 2-(2-amino-1,3-thiazol-4-yl)-N-(3-hydroxypropyl)acetamide.
| Compound Name | 2-(2-amino-1,3-thiazol-4-yl)-N-(3-hydroxypropyl)acetamide |
|---|---|
| PubChem CID | 62797982 |
| Molecular Formula | C8H13N3O2S |
| Molecular Weight | 215.28 g/mol |
| Exact Mass | 215.07 |
| IUPAC Name | 2-(2-amino-1,3-thiazol-4-yl)-N-(3-hydroxypropyl)acetamide |
| SMILES | Nc1nc(CC(=O)NCCCO)cs1 |
| InChI | InChI=1S/C8H13N3O2S/c9-8-11-6(5-14-8)4-7(13)10-2-1-3-12/h5,12H,1-4H2,(H2,9,11)(H,10,13) |
| InChIKey | BDRHSHAIHIOAGW-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 88.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.28 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|