C11H19N3O3S — CID 55119743
2-(2-amino-1,3-thiazol-4-yl)-N-[3-(2-methoxyethoxy)propyl]acetamide (PubChem CID 55119743) has the molecular formula C11H19N3O3S and a molecular weight of 273.36 g/mol. Its IUPAC name is 2-(2-amino-1,3-thiazol-4-yl)-N-[3-(2-methoxyethoxy)propyl]acetamide.
| Compound Name | 2-(2-amino-1,3-thiazol-4-yl)-N-[3-(2-methoxyethoxy)propyl]acetamide |
|---|---|
| PubChem CID | 55119743 |
| Molecular Formula | C11H19N3O3S |
| Molecular Weight | 273.36 g/mol |
| Exact Mass | 273.11 |
| IUPAC Name | 2-(2-amino-1,3-thiazol-4-yl)-N-[3-(2-methoxyethoxy)propyl]acetamide |
| SMILES | COCCOCCCNC(=O)Cc1csc(N)n1 |
| InChI | InChI=1S/C11H19N3O3S/c1-16-5-6-17-4-2-3-13-10(15)7-9-8-18-11(12)14-9/h8H,2-7H2,1H3,(H2,12,14)(H,13,15) |
| InChIKey | ANHBDPXSGGSXBT-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.36 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|